Placeholder

SCIN 131 Name the functional groups

$2.00

Quantity:

Product Description

SCIN 131 Name the functional groups

(a) Write the name of the following compound

CH3-C-(CH3)2-CH2-C-(CH2-CH3)2-CH2-CH2-OH

(b) Name the functional groups in the following compound:

CH3OOC-CH2-CH2-NH-CH3